C28H41N3O2 — CID 73334162
(4-cyclohexylpiperidin-1-yl)-[4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]methanone (PubChem CID 73334162) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is (4-cyclohexylpiperidin-1-yl)-[4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]methanone.
| Compound Name | (4-cyclohexylpiperidin-1-yl)-[4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 73334162 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | (4-cyclohexylpiperidin-1-yl)-[4-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(=O)N2CCC(N3CCCC3)CC2)cc1)N1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C28H41N3O2/c32-27(30-18-12-23(13-19-30)22-6-2-1-3-7-22)24-8-10-25(11-9-24)28(33)31-20-14-26(15-21-31)29-16-4-5-17-29/h8-11,22-23,26H,1-7,12-21H2 |
| InChIKey | ZVUXBUCOYMGOPB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |