C14H14N4O4 — CID 73334233
N-[(E)-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]benzamide (PubChem CID 73334233) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[(E)-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]benzamide.
| Compound Name | N-[(E)-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 73334233 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[(E)-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]benzamide |
| SMILES | CN1C(=O)C(/C=N/NC(=O)c2ccccc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H14N4O4/c1-17-12(20)10(13(21)18(2)14(17)22)8-15-16-11(19)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,16,19)/b15-8+ |
| InChIKey | TWPBICYCXFQQLM-OVCLIPMQSA-N |
| XLogP | 0.07 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|