C23H30N6O2 — CID 73334258
4-amino-2-butoxy-8-(pyrrolidin-1-ylmethyl)-5,6a,7,12-tetrahydroisoquinolino[3,2-h]pteridin-6-one (PubChem CID 73334258) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-(pyrrolidin-1-ylmethyl)-5,6a,7,12-tetrahydroisoquinolino[3,2-h]pteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-(pyrrolidin-1-ylmethyl)-5,6a,7,12-tetrahydroisoquinolino[3,2-h]pteridin-6-one |
|---|---|
| PubChem CID | 73334258 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-amino-2-butoxy-8-(pyrrolidin-1-ylmethyl)-5,6a,7,12-tetrahydroisoquinolino[3,2-h]pteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N1Cc3cccc(CN4CCCC4)c3CC1C(=O)N2 |
| InChI | InChI=1S/C23H30N6O2/c1-2-3-11-31-23-26-20(24)19-21(27-23)29-14-16-8-6-7-15(13-28-9-4-5-10-28)17(16)12-18(29)22(30)25-19/h6-8,18H,2-5,9-14H2,1H3,(H,25,30)(H2,24,26,27) |
| InChIKey | RFPZZSNFPHSBGN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|