C22H30N6O2 — CID 73334259
4-amino-2-butoxy-7-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pteridin-6-one (PubChem CID 73334259) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pteridin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pteridin-6-one |
|---|---|
| PubChem CID | 73334259 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-amino-2-butoxy-7-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)NC(Cc1cccc(CN3CCCC3)c1)C(=O)N2 |
| InChI | InChI=1S/C22H30N6O2/c1-2-3-11-30-22-26-19(23)18-20(27-22)24-17(21(29)25-18)13-15-7-6-8-16(12-15)14-28-9-4-5-10-28/h6-8,12,17H,2-5,9-11,13-14H2,1H3,(H,25,29)(H3,23,24,26,27) |
| InChIKey | NKIMCZAXDODBGZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|