C17H25NO2 — CID 73334401
(1S,6S,8R,9R,10Z)-8-hydroxy-4,13-dimethyl-13-azatricyclo[7.7.0.01,6]hexadeca-3,10-dien-2-one (PubChem CID 73334401) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (1S,6S,8R,9R,10Z)-8-hydroxy-4,13-dimethyl-13-azatricyclo[7.7.0.01,6]hexadeca-3,10-dien-2-one.
| Compound Name | (1S,6S,8R,9R,10Z)-8-hydroxy-4,13-dimethyl-13-azatricyclo[7.7.0.01,6]hexadeca-3,10-dien-2-one |
|---|---|
| PubChem CID | 73334401 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (1S,6S,8R,9R,10Z)-8-hydroxy-4,13-dimethyl-13-azatricyclo[7.7.0.01,6]hexadeca-3,10-dien-2-one |
| SMILES | CC1=CC(=O)[C@]23CCCN(C)C/C=C\[C@H]2[C@H](O)C[C@@H]3C1 |
| InChI | InChI=1S/C17H25NO2/c1-12-9-13-11-15(19)14-5-3-7-18(2)8-4-6-17(13,14)16(20)10-12/h3,5,10,13-15,19H,4,6-9,11H2,1-2H3/b5-3-/t13-,14-,15+,17-/m0/s1 |
| InChIKey | PAVOPTOUFJIDOV-MGDYODQOSA-N |
| XLogP | 2.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|