About (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one
(E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one (PubChem CID 73334404) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one |
| PubChem CID | 73334404 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one |
| SMILES | C/C=C/C(=O)C[C@H]1C[C@@H](O)CCO1 |
| InChI | InChI=1S/C10H16O3/c1-2-3-8(11)6-10-7-9(12)4-5-13-10/h2-3,9-10,12H,4-7H2,1H3/b3-2+/t9-,10-/m0/s1 |
| InChIKey | XAUNHJUQNVIPMK-AQHVTNBVSA-N |
| XLogP | 1.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one?
The IUPAC name of (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one (CID 73334404) is (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one.
What is the SMILES notation for (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one?
The canonical SMILES for (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one is C/C=C/C(=O)C[C@H]1C[C@@H](O)CCO1.
What is the InChIKey of (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one?
The InChIKey is XAUNHJUQNVIPMK-AQHVTNBVSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-3-8(11)6-10-7-9(12)4-5-13-10/h2-3,9-10,12H,4-7H2,1H3/b3-2+/t9-,10-/m0/s1.
What are the key properties of (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one?
(E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one has a molecular weight of 184.24 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[(2R,4S)-4-hydroxyoxan-2-yl]pent-3-en-2-one is sourced from PubChem (CID 73334404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).