C26H16ClF4N5O3 — CID 73334736
4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]-6-(N'-cyano-N,N-dimethylcarbamimidoyl)indazol-3-yl]-3-fluorobenzoic acid (PubChem CID 73334736) has the molecular formula C26H16ClF4N5O3 and a molecular weight of 557.89 g/mol. Its IUPAC name is 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]-6-(N'-cyano-N,N-dimethylcarbamimidoyl)indazol-3-yl]-3-fluorobenzoic acid.
| Compound Name | 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]-6-(N'-cyano-N,N-dimethylcarbamimidoyl)indazol-3-yl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 73334736 |
| Molecular Formula | C26H16ClF4N5O3 |
| Molecular Weight | 557.89 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 4-[1-[2-chloro-6-(trifluoromethyl)benzoyl]-6-(N'-cyano-N,N-dimethylcarbamimidoyl)indazol-3-yl]-3-fluorobenzoic acid |
| SMILES | CN(C)/C(=N\C#N)c1ccc2c(-c3ccc(C(=O)O)cc3F)nn(C(=O)c3c(Cl)cccc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C26H16ClF4N5O3/c1-35(2)23(33-12-32)13-6-9-16-20(11-13)36(24(37)21-17(26(29,30)31)4-3-5-18(21)27)34-22(16)15-8-7-14(25(38)39)10-19(15)28/h3-11H,1-2H3,(H,38,39)/b33-23- |
| InChIKey | BTUVDHKIRBWMFA-SNCSUOKWSA-N |
| XLogP | 5.69 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.89 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|