About (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid
(2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid (PubChem CID 73334745) has the molecular formula C7H9N5O2S
and a molecular weight of 227.25 g/mol. Its IUPAC name is (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid |
| PubChem CID | 73334745 |
| Molecular Formula | C7H9N5O2S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid |
| SMILES | [N-]=[N+]=NCc1cnc(C[C@H](N)C(=O)O)s1 |
| InChI | InChI=1S/C7H9N5O2S/c8-5(7(13)14)1-6-10-2-4(15-6)3-11-12-9/h2,5H,1,3,8H2,(H,13,14)/t5-/m0/s1 |
| InChIKey | VRGIWMDZGYJPKG-YFKPBYRVSA-N |
| XLogP | 0.91 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid?
The IUPAC name of (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid (CID 73334745) is (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid?
The canonical SMILES for (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid is [N-]=[N+]=NCc1cnc(C[C@H](N)C(=O)O)s1.
What is the InChIKey of (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid?
The InChIKey is VRGIWMDZGYJPKG-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H9N5O2S/c8-5(7(13)14)1-6-10-2-4(15-6)3-11-12-9/h2,5H,1,3,8H2,(H,13,14)/t5-/m0/s1.
What are the key properties of (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid?
(2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid has a molecular weight of 227.25 g/mol, XLogP of 0.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-[5-(azidomethyl)-1,3-thiazol-2-yl]propanoic acid is sourced from PubChem (CID 73334745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).