C17H25N — CID 73334860
(E)-3-cyclohexyl-N-[(1R)-1-phenylethyl]prop-2-en-1-amine (PubChem CID 73334860) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (E)-3-cyclohexyl-N-[(1R)-1-phenylethyl]prop-2-en-1-amine.
| Compound Name | (E)-3-cyclohexyl-N-[(1R)-1-phenylethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 73334860 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (E)-3-cyclohexyl-N-[(1R)-1-phenylethyl]prop-2-en-1-amine |
| SMILES | C[C@@H](NC/C=C/C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N/c1-15(17-12-6-3-7-13-17)18-14-8-11-16-9-4-2-5-10-16/h3,6-8,11-13,15-16,18H,2,4-5,9-10,14H2,1H3/b11-8+/t15-/m1/s1 |
| InChIKey | KTDCUHLZWMMFJS-KUCQQTCKSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|