C24H27IN2OS — CID 73334873
3-[(S)-[(2S,5R)-4-[(2-iodophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-thiophen-3-ylmethyl]phenol (PubChem CID 73334873) has the molecular formula C24H27IN2OS and a molecular weight of 518.46 g/mol. Its IUPAC name is 3-[(S)-[(2S,5R)-4-[(2-iodophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-thiophen-3-ylmethyl]phenol.
| Compound Name | 3-[(S)-[(2S,5R)-4-[(2-iodophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-thiophen-3-ylmethyl]phenol |
|---|---|
| PubChem CID | 73334873 |
| Molecular Formula | C24H27IN2OS |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 3-[(S)-[(2S,5R)-4-[(2-iodophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-thiophen-3-ylmethyl]phenol |
| SMILES | C[C@@H]1CN([C@H](c2ccsc2)c2cccc(O)c2)[C@@H](C)CN1Cc1ccccc1I |
| InChI | InChI=1S/C24H27IN2OS/c1-17-14-27(18(2)13-26(17)15-20-6-3-4-9-23(20)25)24(21-10-11-29-16-21)19-7-5-8-22(28)12-19/h3-12,16-18,24,28H,13-15H2,1-2H3/t17-,18+,24+/m1/s1 |
| InChIKey | OMMQUAWOIQZUEE-YTZAWJCFSA-N |
| XLogP | 5.74 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|