About 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one
8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 73335312) has the molecular formula C18H11F5N2O
and a molecular weight of 366.29 g/mol. Its IUPAC name is 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
Molecular Properties
| Compound Name | 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| PubChem CID | 73335312 |
| Molecular Formula | C18H11F5N2O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | O=C1NCCn2c1c(C(F)(F)F)c1cc(F)cc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C18H11F5N2O/c19-10-3-1-9(2-4-10)12-7-11(20)8-13-14(18(21,22)23)16-17(26)24-5-6-25(16)15(12)13/h1-4,7-8H,5-6H2,(H,24,26) |
| InChIKey | LMGTTWDIKXXUGU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The IUPAC name of 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (CID 73335312) is 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
What is the SMILES notation for 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The canonical SMILES for 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is O=C1NCCn2c1c(C(F)(F)F)c1cc(F)cc(-c3ccc(F)cc3)c12.
What is the InChIKey of 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
The InChIKey is LMGTTWDIKXXUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F5N2O/c19-10-3-1-9(2-4-10)12-7-11(20)8-13-14(18(21,22)23)16-17(26)24-5-6-25(16)15(12)13/h1-4,7-8H,5-6H2,(H,24,26).
What are the key properties of 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one?
8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one has a molecular weight of 366.29 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-6-(4-fluorophenyl)-10-(trifluoromethyl)-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one is sourced from PubChem (CID 73335312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).