C43H44N4O6 — CID 73335502
2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate (PubChem CID 73335502) has the molecular formula C43H44N4O6 and a molecular weight of 712.85 g/mol. Its IUPAC name is 2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate.
| Compound Name | 2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 73335502 |
| Molecular Formula | C43H44N4O6 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | 2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC(=O)c4ccc(C(=O)Nc5ccc6c(c5)C(C)(C)CCC6(C)C)cc4)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/C43H44N4O6/c1-7-28-9-8-10-31(23-28)46-39-33-25-37(51-20-19-50-6)38(26-36(33)44-27-45-39)52-21-22-53-41(49)30-13-11-29(12-14-30)40(48)47-32-15-16-34-35(24-32)43(4,5)18-17-42(34,2)3/h1,8-16,23-27H,17-22H2,2-6H3,(H,47,48)(H,44,45,46) |
| InChIKey | BOCGDIORWNNYOP-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|