C33H46N2O4 — CID 73335696
(4aS,6aS,6bR,8aR,12aS,14aS)-11-cyano-N-ethyl-14a-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxamide (PubChem CID 73335696) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is (4aS,6aS,6bR,8aR,12aS,14aS)-11-cyano-N-ethyl-14a-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxamide.
| Compound Name | (4aS,6aS,6bR,8aR,12aS,14aS)-11-cyano-N-ethyl-14a-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 73335696 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | (4aS,6aS,6bR,8aR,12aS,14aS)-11-cyano-N-ethyl-14a-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxamide |
| SMILES | CCNC(=O)[C@]12CCC(C)(C)CC1[C@@]1(O)C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H46N2O4/c1-9-35-26(38)32-14-12-27(2,3)18-23(32)33(39)24(36)16-22-29(6)17-20(19-34)25(37)28(4,5)21(29)10-11-30(22,7)31(33,8)13-15-32/h16-17,21,23,39H,9-15,18H2,1-8H3,(H,35,38)/t21-,23?,29-,30+,31-,32-,33+/m0/s1 |
| InChIKey | GJOWRRJXYRYKDW-YXCZOUSGSA-N |
| XLogP | 5.46 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |