C18H13ClN4O — CID 73335707
6-(6-chloro-3-pyridinyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile (PubChem CID 73335707) has the molecular formula C18H13ClN4O and a molecular weight of 336.78 g/mol. Its IUPAC name is 6-(6-chloro-3-pyridinyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile.
| Compound Name | 6-(6-chloro-3-pyridinyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
|---|---|
| PubChem CID | 73335707 |
| Molecular Formula | C18H13ClN4O |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 6-(6-chloro-3-pyridinyl)-10-methyl-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-8-carbonitrile |
| SMILES | Cc1c2n(c3c(-c4ccc(Cl)nc4)cc(C#N)cc13)CCNC2=O |
| InChI | InChI=1S/C18H13ClN4O/c1-10-13-6-11(8-20)7-14(12-2-3-15(19)22-9-12)17(13)23-5-4-21-18(24)16(10)23/h2-3,6-7,9H,4-5H2,1H3,(H,21,24) |
| InChIKey | VZMRSQLRLNOKJS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|