C13H23F3N2O5 — CID 73335748
(2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-1-(4,4,4-trifluorobutyl)piperidine-2-carboxamide (PubChem CID 73335748) has the molecular formula C13H23F3N2O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-1-(4,4,4-trifluorobutyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-1-(4,4,4-trifluorobutyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 73335748 |
| Molecular Formula | C13H23F3N2O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2S,3R,4S,5R,6R)-N-ethyl-3,4,5-trihydroxy-6-(hydroxymethyl)-1-(4,4,4-trifluorobutyl)piperidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N1CCCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O5/c1-2-17-12(23)8-10(21)11(22)9(20)7(6-19)18(8)5-3-4-13(14,15)16/h7-11,19-22H,2-6H2,1H3,(H,17,23)/t7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | GWKPVBAAFGVADY-QGKZMRNZSA-N |
| XLogP | -1.41 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |