C23H22ClN — CID 73335835
N-[(1R)-1-(3-chlorophenyl)ethyl]-3,3-diphenylprop-2-en-1-amine (PubChem CID 73335835) has the molecular formula C23H22ClN and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)ethyl]-3,3-diphenylprop-2-en-1-amine.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-3,3-diphenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 73335835 |
| Molecular Formula | C23H22ClN |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-3,3-diphenylprop-2-en-1-amine |
| SMILES | C[C@@H](NCC=C(c1ccccc1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClN/c1-18(21-13-8-14-22(24)17-21)25-16-15-23(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-15,17-18,25H,16H2,1H3/t18-/m1/s1 |
| InChIKey | XGBQLFCYDCNVPI-GOSISDBHSA-N |
| XLogP | 6.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |