C29H24N2O6 — CID 73335993
methyl 4-[(3E)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 73335993) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is methyl 4-[(3E)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 73335993 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl 4-[(3E)-3-[hydroxy-(3-hydroxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(\O)c3cccc(O)c3)C(=O)C(=O)N2CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H24N2O6/c1-37-29(36)18-11-9-17(10-12-18)25-24(26(33)19-5-4-6-21(32)15-19)27(34)28(35)31(25)14-13-20-16-30-23-8-3-2-7-22(20)23/h2-12,15-16,25,30,32-33H,13-14H2,1H3/b26-24+ |
| InChIKey | FWYXGPWRESWFSF-SHHOIMCASA-N |
| XLogP | 4.32 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|