C24H23N5O — CID 7333806
[3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-(2-methylphenyl)methanone (PubChem CID 7333806) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is [3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 7333806 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)n1nc(NCc2ccccc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C24H23N5O/c1-18-10-8-9-15-21(18)22(30)29-24(26-17-20-13-6-3-7-14-20)27-23(28-29)25-16-19-11-4-2-5-12-19/h2-15H,16-17H2,1H3,(H2,25,26,27,28) |
| InChIKey | VGDJOTARCYIDHJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |