C21H20FN5O3S — CID 73338863
N-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxo-3H-pyridine-3-carboxamide (PubChem CID 73338863) has the molecular formula C21H20FN5O3S and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxo-3H-pyridine-3-carboxamide.
| Compound Name | N-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxo-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 73338863 |
| Molecular Formula | C21H20FN5O3S |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[4-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxo-3H-pyridine-3-carboxamide |
| SMILES | O=C1N=CC=CC1C(=O)Nc1nc(CC(=O)N2CCN(c3ccccc3F)CC2)cs1 |
| InChI | InChI=1S/C21H20FN5O3S/c22-16-5-1-2-6-17(16)26-8-10-27(11-9-26)18(28)12-14-13-31-21(24-14)25-20(30)15-4-3-7-23-19(15)29/h1-7,13,15H,8-12H2,(H,24,25,30) |
| InChIKey | XEQBFTCLWVQJAP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|