C22H28N6OS — CID 73339685
N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 73339685) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 73339685 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[2-[6-ethylsulfanyl-4-(2-methylpropylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CCSc1nc(NCC(C)C)c2cnn(CCNC(=O)C=Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C22H28N6OS/c1-4-30-22-26-20(24-14-16(2)3)18-15-25-28(21(18)27-22)13-12-23-19(29)11-10-17-8-6-5-7-9-17/h5-11,15-16H,4,12-14H2,1-3H3,(H,23,29)(H,24,26,27) |
| InChIKey | YVSKZHGGBDAPBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|