C15H20ClN5O4 — CID 73344950
4-chloro-N-[3-(morpholin-4-ylmethyl)phenyl]-5-nitropyrazolidine-3-carboxamide (PubChem CID 73344950) has the molecular formula C15H20ClN5O4 and a molecular weight of 369.81 g/mol. Its IUPAC name is 4-chloro-N-[3-(morpholin-4-ylmethyl)phenyl]-5-nitropyrazolidine-3-carboxamide.
| Compound Name | 4-chloro-N-[3-(morpholin-4-ylmethyl)phenyl]-5-nitropyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 73344950 |
| Molecular Formula | C15H20ClN5O4 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-chloro-N-[3-(morpholin-4-ylmethyl)phenyl]-5-nitropyrazolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(CN2CCOCC2)c1)C1NNC([N+](=O)[O-])C1Cl |
| InChI | InChI=1S/C15H20ClN5O4/c16-12-13(18-19-14(12)21(23)24)15(22)17-11-3-1-2-10(8-11)9-20-4-6-25-7-5-20/h1-3,8,12-14,18-19H,4-7,9H2,(H,17,22) |
| InChIKey | FZADOHZQLIACBN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|