C35H44N2O6 — CID 73345198
tert-butyl N-[(2S,3S,5R)-5-[[(1R,2S,3R)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-3-hydroxy-1,8-diphenyloctan-2-yl]carbamate (PubChem CID 73345198) has the molecular formula C35H44N2O6 and a molecular weight of 588.75 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-5-[[(1R,2S,3R)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-3-hydroxy-1,8-diphenyloctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-5-[[(1R,2S,3R)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-3-hydroxy-1,8-diphenyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 73345198 |
| Molecular Formula | C35H44N2O6 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-5-[[(1R,2S,3R)-2,3-dihydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-3-hydroxy-1,8-diphenyloctan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@@H](CCCc1ccccc1)C(=O)N[C@@H]1c2ccccc2[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C35H44N2O6/c1-35(2,3)43-34(42)36-28(21-24-15-8-5-9-16-24)29(38)22-25(18-12-17-23-13-6-4-7-14-23)33(41)37-30-26-19-10-11-20-27(26)31(39)32(30)40/h4-11,13-16,19-20,25,28-32,38-40H,12,17-18,21-22H2,1-3H3,(H,36,42)(H,37,41)/t25-,28+,29+,30-,31-,32+/m1/s1 |
| InChIKey | BNEUUKYSHWONFU-SZGRBJMUSA-N |
| XLogP | 4.78 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |