C35H42O9 — CID 73345322
(1S,2R,4S,9R)-5',9-dimethoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-chromene]-6,8',10-trione (PubChem CID 73345322) has the molecular formula C35H42O9 and a molecular weight of 606.71 g/mol. Its IUPAC name is (1S,2R,4S,9R)-5',9-dimethoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-chromene]-6,8',10-trione.
| Compound Name | (1S,2R,4S,9R)-5',9-dimethoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-chromene]-6,8',10-trione |
|---|---|
| PubChem CID | 73345322 |
| Molecular Formula | C35H42O9 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | (1S,2R,4S,9R)-5',9-dimethoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-chromene]-6,8',10-trione |
| SMILES | COC1=C(CC=C(C)C)[C@]2(OC(=O)C3=C[C@]4(OC)C[C@H]5C(C)(C)OC(CC=C(C)C)(C4=O)[C@]35O2)C(=O)C2=C1C=CC(C)(C)O2 |
| InChI | InChI=1S/C35H42O9/c1-19(2)11-12-22-25(39-9)21-14-15-30(5,6)41-26(21)27(36)35(22)42-28(37)23-17-32(40-10)18-24-31(7,8)43-33(29(32)38,16-13-20(3)4)34(23,24)44-35/h11,13-15,17,24H,12,16,18H2,1-10H3/t24-,32-,33?,34-,35+/m0/s1 |
| InChIKey | OJOANDFOHUOILN-YUTKUMPGSA-N |
| XLogP | 5.27 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|