C34H44N4O5S2 — CID 73345835
(2R)-2-[(3S,4R)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-sulfanylpyrrolidin-3-yl]sulfanyl-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide (PubChem CID 73345835) has the molecular formula C34H44N4O5S2 and a molecular weight of 652.88 g/mol. Its IUPAC name is (2R)-2-[(3S,4R)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-sulfanylpyrrolidin-3-yl]sulfanyl-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide.
| Compound Name | (2R)-2-[(3S,4R)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-sulfanylpyrrolidin-3-yl]sulfanyl-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 73345835 |
| Molecular Formula | C34H44N4O5S2 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | (2R)-2-[(3S,4R)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-sulfanylpyrrolidin-3-yl]sulfanyl-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CC(C)C)S[C@H]1CN(C(=O)CCCCCN2C(=O)c3ccccc3C2=O)C[C@H]1S |
| InChI | InChI=1S/C34H44N4O5S2/c1-22(2)18-28(32(41)36-26(31(40)35-3)19-23-12-6-4-7-13-23)45-29-21-37(20-27(29)44)30(39)16-8-5-11-17-38-33(42)24-14-9-10-15-25(24)34(38)43/h4,6-7,9-10,12-15,22,26-29,44H,5,8,11,16-21H2,1-3H3,(H,35,40)(H,36,41)/t26-,27+,28+,29-/m0/s1 |
| InChIKey | RYDPXGZLAKQPJB-AUAHOFGGSA-N |
| XLogP | 3.97 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|