C27H28O4S — CID 73345985
(5Z)-5-[(2Z)-3,7-dimethylocta-2,6-dienylidene]-4-(4-methylsulfonylphenyl)-3-phenylfuran-2-one (PubChem CID 73345985) has the molecular formula C27H28O4S and a molecular weight of 448.58 g/mol. Its IUPAC name is (5Z)-5-[(2Z)-3,7-dimethylocta-2,6-dienylidene]-4-(4-methylsulfonylphenyl)-3-phenylfuran-2-one.
| Compound Name | (5Z)-5-[(2Z)-3,7-dimethylocta-2,6-dienylidene]-4-(4-methylsulfonylphenyl)-3-phenylfuran-2-one |
|---|---|
| PubChem CID | 73345985 |
| Molecular Formula | C27H28O4S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (5Z)-5-[(2Z)-3,7-dimethylocta-2,6-dienylidene]-4-(4-methylsulfonylphenyl)-3-phenylfuran-2-one |
| SMILES | CC(C)=CCC/C(C)=C\C=C1/OC(=O)C(c2ccccc2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H28O4S/c1-19(2)9-8-10-20(3)13-18-24-25(22-14-16-23(17-15-22)32(4,29)30)26(27(28)31-24)21-11-6-5-7-12-21/h5-7,9,11-18H,8,10H2,1-4H3/b20-13-,24-18- |
| InChIKey | ASGPIGFSHWUKJO-ZAILDJOHSA-N |
| XLogP | 6.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|