About N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride
N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride (PubChem CID 73346038) has the molecular formula C17H17ClFN3O3
and a molecular weight of 365.79 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride |
| PubChem CID | 73346038 |
| Molecular Formula | C17H17ClFN3O3 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2ncnc(Nc3cccc(F)c3)c2c(OC)c1OC.Cl |
| InChI | InChI=1S/C17H16FN3O3.ClH/c1-22-13-8-12-14(16(24-3)15(13)23-2)17(20-9-19-12)21-11-6-4-5-10(18)7-11;/h4-9H,1-3H3,(H,19,20,21);1H |
| InChIKey | TXQJRSXMNVBCOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride?
The IUPAC name of N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride (CID 73346038) is N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride.
What is the SMILES notation for N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride?
The canonical SMILES for N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride is COc1cc2ncnc(Nc3cccc(F)c3)c2c(OC)c1OC.Cl.
What is the InChIKey of N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride?
The InChIKey is TXQJRSXMNVBCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O3.ClH/c1-22-13-8-12-14(16(24-3)15(13)23-2)17(20-9-19-12)21-11-6-4-5-10(18)7-11;/h4-9H,1-3H3,(H,19,20,21);1H.
What are the key properties of N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride?
N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride has a molecular weight of 365.79 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-5,6,7-trimethoxyquinazolin-4-amine;hydrochloride is sourced from PubChem (CID 73346038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).