C36H26IN7O7S2 — CID 73346127
5-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 73346127) has the molecular formula C36H26IN7O7S2 and a molecular weight of 859.68 g/mol. Its IUPAC name is 5-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 73346127 |
| Molecular Formula | C36H26IN7O7S2 |
| Molecular Weight | 859.68 g/mol |
| Exact Mass | 859.04 |
| IUPAC Name | 5-[3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C36H26IN7O7S2/c37-24-13-27-28(50-16-49-27)14-29(24)53-36-43-31-32(38)40-15-41-33(31)44(36)9-1-8-39-35(52)42-17-2-5-20(23(10-17)34(47)48)30-21-6-3-18(45)11-25(21)51-26-12-19(46)4-7-22(26)30/h2-7,10-15,45H,1,8-9,16H2,(H,47,48)(H2,38,40,41)(H2,39,42,52) |
| InChIKey | WOMJYJBQSUKEIE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|