C26H30N2O12 — CID 73346131
[(2R,3S,4S,5R,6R)-6-[[(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 73346131) has the molecular formula C26H30N2O12 and a molecular weight of 562.53 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[[(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[[(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 73346131 |
| Molecular Formula | C26H30N2O12 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(2R,3S,4S,5R,6R)-6-[(R)-cyano(phenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | N#C[C@H](O[C@@H]1O[C@H](CO[C@@H]2O[C@H](COC(=O)c3cccnc3)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O12/c27-9-15(13-5-2-1-3-6-13)38-26-23(34)21(32)19(30)17(40-26)12-37-25-22(33)20(31)18(29)16(39-25)11-36-24(35)14-7-4-8-28-10-14/h1-8,10,15-23,25-26,29-34H,11-12H2/t15-,16+,17+,18+,19+,20-,21-,22+,23+,25+,26+/m0/s1 |
| InChIKey | LGPUIKWJKFIAIH-LJKDYDQHSA-N |
| XLogP | -1.85 |
| TPSA | 221.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |