C21H14Cl5NO2S — CID 73346159
2-(2,3,4,5,6-pentachlorophenyl)sulfanyl-3-piperidin-1-ylnaphthalene-1,4-dione (PubChem CID 73346159) has the molecular formula C21H14Cl5NO2S and a molecular weight of 521.68 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentachlorophenyl)sulfanyl-3-piperidin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-(2,3,4,5,6-pentachlorophenyl)sulfanyl-3-piperidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 73346159 |
| Molecular Formula | C21H14Cl5NO2S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 518.92 |
| IUPAC Name | 2-(2,3,4,5,6-pentachlorophenyl)sulfanyl-3-piperidin-1-ylnaphthalene-1,4-dione |
| SMILES | O=C1C(Sc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)=C(N2CCCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H14Cl5NO2S/c22-12-13(23)15(25)20(16(26)14(12)24)30-21-17(27-8-4-1-5-9-27)18(28)10-6-2-3-7-11(10)19(21)29/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | HKEABVWKKMVBJG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|