C44H38F3N3O3 — CID 73346234
4,10-diphenyl-2-[4-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]butyl]indeno[1,2-f]isoindole-1,3,9-trione (PubChem CID 73346234) has the molecular formula C44H38F3N3O3 and a molecular weight of 713.80 g/mol. Its IUPAC name is 4,10-diphenyl-2-[4-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]butyl]indeno[1,2-f]isoindole-1,3,9-trione.
| Compound Name | 4,10-diphenyl-2-[4-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]butyl]indeno[1,2-f]isoindole-1,3,9-trione |
|---|---|
| PubChem CID | 73346234 |
| Molecular Formula | C44H38F3N3O3 |
| Molecular Weight | 713.80 g/mol |
| Exact Mass | 713.29 |
| IUPAC Name | 4,10-diphenyl-2-[4-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]butyl]indeno[1,2-f]isoindole-1,3,9-trione |
| SMILES | O=c1c2ccccc2c2c(-c3ccccc3)c3c(=O)n(CCCCN4CCN(CCc5ccccc5C(F)(F)F)CC4)c(=O)c3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C44H38F3N3O3/c45-44(46,47)34-20-10-7-13-29(34)21-24-49-27-25-48(26-28-49)22-11-12-23-50-42(52)39-35(30-14-3-1-4-15-30)37-32-18-8-9-19-33(32)41(51)38(37)36(40(39)43(50)53)31-16-5-2-6-17-31/h1-10,13-20H,11-12,21-28H2 |
| InChIKey | JZFZKVURTUGTJD-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.80 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|