C25H24F2N4O2 — CID 73346314
2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]-1-(2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[5,4-c]pyridin-5-yl)ethanone (PubChem CID 73346314) has the molecular formula C25H24F2N4O2 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]-1-(2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[5,4-c]pyridin-5-yl)ethanone.
| Compound Name | 2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]-1-(2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[5,4-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 73346314 |
| Molecular Formula | C25H24F2N4O2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[4-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)imidazol-1-yl]-1-(2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]oxazolo[5,4-c]pyridin-5-yl)ethanone |
| SMILES | CC1=NC2CCN(C(=O)Cn3cc(-c4ccc(F)c(C)c4)nc3-c3ccc(F)cc3)CC2O1 |
| InChI | InChI=1S/C25H24F2N4O2/c1-15-11-18(5-8-20(15)27)22-12-31(25(29-22)17-3-6-19(26)7-4-17)14-24(32)30-10-9-21-23(13-30)33-16(2)28-21/h3-8,11-12,21,23H,9-10,13-14H2,1-2H3 |
| InChIKey | WDPTXUVLMFMBCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |