C19H25NS — CID 73346425
3-phenyl-N-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]propan-1-amine (PubChem CID 73346425) has the molecular formula C19H25NS and a molecular weight of 299.48 g/mol. Its IUPAC name is 3-phenyl-N-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]propan-1-amine.
| Compound Name | 3-phenyl-N-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 73346425 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-phenyl-N-[2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)ethyl]propan-1-amine |
| SMILES | c1ccc(CCCNCCC2CCCc3sccc32)cc1 |
| InChI | InChI=1S/C19H25NS/c1-2-6-16(7-3-1)8-5-13-20-14-11-17-9-4-10-19-18(17)12-15-21-19/h1-3,6-7,12,15,17,20H,4-5,8-11,13-14H2 |
| InChIKey | LOPJNCUIJKUCMY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|