C9H13N5 — CID 73346433
6-[(1S)-cyclohex-2-en-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 73346433) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 6-[(1S)-cyclohex-2-en-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-cyclohex-2-en-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 73346433 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 6-[(1S)-cyclohex-2-en-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc([C@@H]2C=CCCC2)n1 |
| InChI | InChI=1S/C9H13N5/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6/h2,4,6H,1,3,5H2,(H4,10,11,12,13,14)/t6-/m1/s1 |
| InChIKey | YRTUTIAAXFGSAM-ZCFIWIBFSA-N |
| XLogP | 0.86 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|