About 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione
2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione (PubChem CID 73346552) has the molecular formula C22H15N5O4
and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione |
| PubChem CID | 73346552 |
| Molecular Formula | C22H15N5O4 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1C=C(NCc2cn(CN3C(=O)c4ccccc4C3=O)nn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H15N5O4/c28-19-9-18(20(29)15-6-2-1-5-14(15)19)23-10-13-11-26(25-24-13)12-27-21(30)16-7-3-4-8-17(16)22(27)31/h1-9,11,23H,10,12H2 |
| InChIKey | NMBYSNURAOTDCI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione?
The IUPAC name of 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione (CID 73346552) is 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione?
The canonical SMILES for 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione is O=C1C=C(NCc2cn(CN3C(=O)c4ccccc4C3=O)nn2)C(=O)c2ccccc21.
What is the InChIKey of 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione?
The InChIKey is NMBYSNURAOTDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N5O4/c28-19-9-18(20(29)15-6-2-1-5-14(15)19)23-10-13-11-26(25-24-13)12-27-21(30)16-7-3-4-8-17(16)22(27)31/h1-9,11,23H,10,12H2.
What are the key properties of 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione?
2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione has a molecular weight of 413.39 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[[(1,4-dioxonaphthalen-2-yl)amino]methyl]triazol-1-yl]methyl]isoindole-1,3-dione is sourced from PubChem (CID 73346552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).