C19H22IN5O5 — CID 73346859
(2R,3R,4S,5R)-2-[6-[[(2R)-1-(4-hydroxy-3-iodophenyl)propan-2-yl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 73346859) has the molecular formula C19H22IN5O5 and a molecular weight of 527.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[[(2R)-1-(4-hydroxy-3-iodophenyl)propan-2-yl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[[(2R)-1-(4-hydroxy-3-iodophenyl)propan-2-yl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 73346859 |
| Molecular Formula | C19H22IN5O5 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[(2R)-1-(4-hydroxy-3-iodophenyl)propan-2-yl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C[C@H](Cc1ccc(O)c(I)c1)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22IN5O5/c1-9(4-10-2-3-12(27)11(20)5-10)24-17-14-18(22-7-21-17)25(8-23-14)19-16(29)15(28)13(6-26)30-19/h2-3,5,7-9,13,15-16,19,26-29H,4,6H2,1H3,(H,21,22,24)/t9-,13-,15-,16-,19-/m1/s1 |
| InChIKey | UYWJRWJYHIMDES-DQXDPGMCSA-N |
| XLogP | 0.79 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|