C20H29NaO6 — CID 73346869
sodium (5Z)-5-[(3aR,4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 73346869) has the molecular formula C20H29NaO6 and a molecular weight of 388.44 g/mol. Its IUPAC name is sodium (5Z)-5-[(3aR,4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | sodium (5Z)-5-[(3aR,4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 73346869 |
| Molecular Formula | C20H29NaO6 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | sodium (5Z)-5-[(3aR,4R,5R)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC2O/C(=C\CCCC(=O)[O-])C(=O)[C@@H]21.[Na+] |
| InChI | InChI=1S/C20H30O6.Na/c1-2-3-4-7-13(21)10-11-14-15(22)12-17-19(14)20(25)16(26-17)8-5-6-9-18(23)24;/h8,10-11,13-15,17,19,21-22H,2-7,9,12H2,1H3,(H,23,24);/q;+1/p-1/b11-10+,16-8-;/t13-,14-,15+,17?,19+;/m0./s1 |
| InChIKey | YYCIBTCQCMPCMU-HXOGNVGWSA-M |
| XLogP | -1.74 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|