C25H47N5O11 — CID 73346993
(2S)-6-amino-2-[[2-[[(2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoyl]amino]pentanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 73346993) has the molecular formula C25H47N5O11 and a molecular weight of 593.68 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoyl]amino]pentanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[(2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoyl]amino]pentanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 73346993 |
| Molecular Formula | C25H47N5O11 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoyl]amino]pentanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C25H47N5O11/c1-12(2)9-15(22(37)27-10-17(33)28-14(25(40)41)7-5-6-8-26)29-23(38)18(13(3)4)30-24(39)21(36)20(35)19(34)16(32)11-31/h12-16,18-21,31-32,34-36H,5-11,26H2,1-4H3,(H,27,37)(H,28,33)(H,29,38)(H,30,39)(H,40,41)/t14-,15-,16+,18-,19+,20-,21+/m0/s1 |
| InChIKey | FERFSXUSVXPWQR-SNCGNRLASA-N |
| XLogP | -4.09 |
| TPSA | 280.87 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|