C21H41N9O5 — CID 73347180
tert-butyl N-[(2R)-5-(diaminomethylideneamino)-1-[[1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 73347180) has the molecular formula C21H41N9O5 and a molecular weight of 499.62 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-(diaminomethylideneamino)-1-[[1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-(diaminomethylideneamino)-1-[[1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 73347180 |
| Molecular Formula | C21H41N9O5 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | tert-butyl N-[(2R)-5-(diaminomethylideneamino)-1-[[1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCN=C(N)N)C(=O)NC(C)(C)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C21H41N9O5/c1-20(2,3)35-19(34)29-14(9-7-11-27-18(24)25)15(32)30-21(4,5)16(33)28-13(12-31)8-6-10-26-17(22)23/h12-14H,6-11H2,1-5H3,(H,28,33)(H,29,34)(H,30,32)(H4,22,23,26)(H4,24,25,27)/t13-,14+/m0/s1 |
| InChIKey | FKRMWNANNKJCTQ-UONOGXRCSA-N |
| XLogP | -1.43 |
| TPSA | 242.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|