C31H43N5O9 — CID 73347212
(2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 73347212) has the molecular formula C31H43N5O9 and a molecular weight of 629.71 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 73347212 |
| Molecular Formula | C31H43N5O9 |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C31H43N5O9/c1-3-18(2)26(30(43)34-23(15-19-9-5-4-6-10-19)29(42)35-24(17-37)31(44)45)36-28(41)22(11-7-8-14-32)33-27(40)21-16-20(38)12-13-25(21)39/h4-6,9-10,12-13,16,18,22-24,26,37-39H,3,7-8,11,14-15,17,32H2,1-2H3,(H,33,40)(H,34,43)(H,35,42)(H,36,41)(H,44,45)/t18-,22-,23-,24-,26-/m0/s1 |
| InChIKey | YEPVKQKINOHPFV-DQMQTHDISA-N |
| XLogP | 0.15 |
| TPSA | 240.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|