C32H45N5O9 — CID 73347215
(2S,3R)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 73347215) has the molecular formula C32H45N5O9 and a molecular weight of 643.74 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 73347215 |
| Molecular Formula | C32H45N5O9 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | (2S,3R)-2-[[(2S)-2-[[(2S,3S)-2-[[(2S)-6-amino-2-[(2,5-dihydroxybenzoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)c1cc(O)ccc1O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C32H45N5O9/c1-4-18(2)26(36-29(42)23(12-8-9-15-33)34-28(41)22-17-21(39)13-14-25(22)40)31(44)35-24(16-20-10-6-5-7-11-20)30(43)37-27(19(3)38)32(45)46/h5-7,10-11,13-14,17-19,23-24,26-27,38-40H,4,8-9,12,15-16,33H2,1-3H3,(H,34,41)(H,35,44)(H,36,42)(H,37,43)(H,45,46)/t18-,19+,23-,24-,26-,27-/m0/s1 |
| InChIKey | XWCSIGQZHJLAFA-ZFBDNBDMSA-N |
| XLogP | 0.53 |
| TPSA | 240.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|