C31H51NO6S — CID 73347272
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-methyl-1-(2-methylpropoxycarbonylamino)propan-2-yl]sulfanylacetate (PubChem CID 73347272) has the molecular formula C31H51NO6S and a molecular weight of 565.82 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-methyl-1-(2-methylpropoxycarbonylamino)propan-2-yl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-methyl-1-(2-methylpropoxycarbonylamino)propan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 73347272 |
| Molecular Formula | C31H51NO6S |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-methyl-1-(2-methylpropoxycarbonylamino)propan-2-yl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC(C)(C)CNC(=O)OCC(C)C)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H51NO6S/c1-10-29(8)15-23(38-24(34)17-39-28(6,7)18-32-27(36)37-16-19(2)3)30(9)20(4)11-13-31(21(5)26(29)35)14-12-22(33)25(30)31/h10,19-21,23,25-26,35H,1,11-18H2,2-9H3,(H,32,36)/t20-,21+,23-,25+,26+,29-,30+,31+/m1/s1 |
| InChIKey | XCVIJBRVZLAJRC-XNMWOHQUSA-N |
| XLogP | 5.79 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|