C28H42O5 — CID 73347276
[(1R,3R,4R,5R,6R,10S,12S,13S,16R,18S,21R)-18-hydroxy-4,6,12,17,17-pentamethyl-8-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-3-yl] acetate (PubChem CID 73347276) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(1R,3R,4R,5R,6R,10S,12S,13S,16R,18S,21R)-18-hydroxy-4,6,12,17,17-pentamethyl-8-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-3-yl] acetate.
| Compound Name | [(1R,3R,4R,5R,6R,10S,12S,13S,16R,18S,21R)-18-hydroxy-4,6,12,17,17-pentamethyl-8-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-3-yl] acetate |
|---|---|
| PubChem CID | 73347276 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [(1R,3R,4R,5R,6R,10S,12S,13S,16R,18S,21R)-18-hydroxy-4,6,12,17,17-pentamethyl-8-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]23C[C@@]24CC[C@H](O)C(C)(C)[C@@H]4CC[C@H]3[C@]2(C)C[C@@H]3OC(=O)C[C@@H](C)[C@@H]3[C@@]12C |
| InChI | InChI=1S/C28H42O5/c1-15-11-22(31)33-17-12-25(5)19-8-7-18-24(3,4)20(30)9-10-27(18)14-28(19,27)13-21(32-16(2)29)26(25,6)23(15)17/h15,17-21,23,30H,7-14H2,1-6H3/t15-,17+,18+,19+,20+,21-,23+,25+,26-,27-,28+/m1/s1 |
| InChIKey | RPOZCCBNIDBVCM-JTODIARKSA-N |
| XLogP | 4.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |