About methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate
methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 73347380) has the molecular formula C18H14FN5O2S
and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
Molecular Properties
| Compound Name | methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| PubChem CID | 73347380 |
| Molecular Formula | C18H14FN5O2S |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4ccc(F)cc4OC)c3c2s1 |
| InChI | InChI=1S/C18H14FN5O2S/c1-25-13-7-9(19)3-4-10(13)23-17-14-11(21-8-22-17)5-6-12-15(14)27-18(24-12)16(20)26-2/h3-8,20H,1-2H3,(H,21,22,23)/b20-16- |
| InChIKey | ZPXSIWLYMMFFCE-SILNSSARSA-N |
| XLogP | 4.10 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The IUPAC name of methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (CID 73347380) is methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
What is the SMILES notation for methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The canonical SMILES for methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4ccc(F)cc4OC)c3c2s1.
What is the InChIKey of methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The InChIKey is ZPXSIWLYMMFFCE-SILNSSARSA-N. The full InChI is InChI=1S/C18H14FN5O2S/c1-25-13-7-9(19)3-4-10(13)23-17-14-11(21-8-22-17)5-6-12-15(14)27-18(24-12)16(20)26-2/h3-8,20H,1-2H3,(H,21,22,23)/b20-16-.
What are the key properties of methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate has a molecular weight of 383.41 g/mol, XLogP of 4.10, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-(4-fluoro-2-methoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is sourced from PubChem (CID 73347380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).