C38H46ClN5O2 — CID 73347432
N-[6-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butylamino]-6-oxohexyl]-2-(2,3-dimethylanilino)benzamide (PubChem CID 73347432) has the molecular formula C38H46ClN5O2 and a molecular weight of 640.27 g/mol. Its IUPAC name is N-[6-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butylamino]-6-oxohexyl]-2-(2,3-dimethylanilino)benzamide.
| Compound Name | N-[6-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butylamino]-6-oxohexyl]-2-(2,3-dimethylanilino)benzamide |
|---|---|
| PubChem CID | 73347432 |
| Molecular Formula | C38H46ClN5O2 |
| Molecular Weight | 640.27 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | N-[6-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]butylamino]-6-oxohexyl]-2-(2,3-dimethylanilino)benzamide |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)NCCCCCC(=O)NCCCCNc2c3c(nc4cc(Cl)ccc24)CCCC3)c1C |
| InChI | InChI=1S/C38H46ClN5O2/c1-26-13-12-18-32(27(26)2)43-34-17-8-6-15-31(34)38(46)42-24-9-3-4-19-36(45)40-22-10-11-23-41-37-29-14-5-7-16-33(29)44-35-25-28(39)20-21-30(35)37/h6,8,12-13,15,17-18,20-21,25,43H,3-5,7,9-11,14,16,19,22-24H2,1-2H3,(H,40,45)(H,41,44)(H,42,46) |
| InChIKey | XWGBBESHNNQHBU-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.27 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|