C17H19ClN4 — CID 73347457
2-[(E)-[(E)-1-(4-methylphenyl)-3-phenylprop-2-enylidene]amino]guanidine;hydrochloride (PubChem CID 73347457) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-[(E)-[(E)-1-(4-methylphenyl)-3-phenylprop-2-enylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-[(E)-1-(4-methylphenyl)-3-phenylprop-2-enylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 73347457 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[(E)-[(E)-1-(4-methylphenyl)-3-phenylprop-2-enylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1ccc(C(/C=C/c2ccccc2)=N/N=C(N)N)cc1.Cl |
| InChI | InChI=1S/C17H18N4.ClH/c1-13-7-10-15(11-8-13)16(20-21-17(18)19)12-9-14-5-3-2-4-6-14;/h2-12H,1H3,(H4,18,19,21);1H/b12-9+,20-16+; |
| InChIKey | RPHAHGPEIHLZNN-JNDFZVOESA-N |
| XLogP | 3.11 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|