C20H23ClO4 — CID 73347533
(1S,5R,7Z,10R,13S)-5-(4-chlorophenyl)-13-ethoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one (PubChem CID 73347533) has the molecular formula C20H23ClO4 and a molecular weight of 362.85 g/mol. Its IUPAC name is (1S,5R,7Z,10R,13S)-5-(4-chlorophenyl)-13-ethoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one.
| Compound Name | (1S,5R,7Z,10R,13S)-5-(4-chlorophenyl)-13-ethoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
|---|---|
| PubChem CID | 73347533 |
| Molecular Formula | C20H23ClO4 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (1S,5R,7Z,10R,13S)-5-(4-chlorophenyl)-13-ethoxy-4,14-dioxabicyclo[8.3.1]tetradeca-7,11-dien-3-one |
| SMILES | CCO[C@H]1C=C[C@H]2C/C=C\C[C@H](c3ccc(Cl)cc3)OC(=O)C[C@@H]1O2 |
| InChI | InChI=1S/C20H23ClO4/c1-2-23-18-12-11-16-5-3-4-6-17(14-7-9-15(21)10-8-14)25-20(22)13-19(18)24-16/h3-4,7-12,16-19H,2,5-6,13H2,1H3/b4-3-/t16-,17-,18+,19+/m1/s1 |
| InChIKey | BHYRXNDJECEOBG-HVSUOPIZSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|