C21H23NO4 — CID 73347534
2-[(4R)-4-hydroxy-1-(2-phenylacetyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 73347534) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[(4R)-4-hydroxy-1-(2-phenylacetyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[(4R)-4-hydroxy-1-(2-phenylacetyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 73347534 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[(4R)-4-hydroxy-1-(2-phenylacetyl)pyrrolidin-2-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CC2C[C@@H](O)CN2C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-26-19-9-7-16(8-10-19)20(24)13-17-12-18(23)14-22(17)21(25)11-15-5-3-2-4-6-15/h2-10,17-18,23H,11-14H2,1H3/t17?,18-/m1/s1 |
| InChIKey | GIQCYSPTOAFEDJ-QRWMCTBCSA-N |
| XLogP | 2.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |