C15H22O2 — CID 73347659
(4Z,6S,9R)-6-hydroxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-3-one (PubChem CID 73347659) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4Z,6S,9R)-6-hydroxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-3-one.
| Compound Name | (4Z,6S,9R)-6-hydroxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-3-one |
|---|---|
| PubChem CID | 73347659 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4Z,6S,9R)-6-hydroxy-2,2,5,9-tetramethyl-6,7,8,9-tetrahydro-1H-cyclopenta[8]annulen-3-one |
| SMILES | C/C1=C/C2=C(CC(C)(C)C2=O)[C@H](C)CC[C@@H]1O |
| InChI | InChI=1S/C15H22O2/c1-9-5-6-13(16)10(2)7-11-12(9)8-15(3,4)14(11)17/h7,9,13,16H,5-6,8H2,1-4H3/b10-7-/t9-,13+/m1/s1 |
| InChIKey | XWJRORQTJORDHX-QBLALBGASA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |