C27H44O4 — CID 73347675
(9E,11S,12S)-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one (PubChem CID 73347675) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (9E,11S,12S)-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E,11S,12S)-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 73347675 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (9E,11S,12S)-12-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-11-methyl-1-oxacyclododec-9-en-2-one |
| SMILES | CC[C@H](O)[C@@H](C)[C@H]1O[C@@H]1C[C@H](C)/C=C/C=C(\C)[C@H]1OC(=O)CCCCCC/C=C/[C@@H]1C |
| InChI | InChI=1S/C27H44O4/c1-6-23(28)22(5)27-24(30-27)18-19(2)14-13-16-21(4)26-20(3)15-11-9-7-8-10-12-17-25(29)31-26/h11,13-16,19-20,22-24,26-28H,6-10,12,17-18H2,1-5H3/b14-13+,15-11+,21-16+/t19-,20+,22-,23+,24-,26+,27-/m1/s1 |
| InChIKey | KBXKNKZCJANIIA-KMHPUMCQSA-N |
| XLogP | 6.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|