C18H15N3O4 — CID 73347713
2-(1,3-dioxoisoindol-2-yl)-N-[(E)-(3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 73347713) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(E)-(3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(E)-(3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 73347713 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(E)-(3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N/NC(=O)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H15N3O4/c1-25-13-6-4-5-12(9-13)10-19-20-16(22)11-21-17(23)14-7-2-3-8-15(14)18(21)24/h2-10H,11H2,1H3,(H,20,22)/b19-10+ |
| InChIKey | IFVRGWBMRKCZNO-VXLYETTFSA-N |
| XLogP | 1.44 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|